| Identification | |
| Name: | BENZIDINE SULFATE |
| CAS: | 531-86-2 |
| EINECS: | 244-236-4 |
| Molecular Formula: | C12H12N2•H2O4S |
| Molecular Weight: | 184.23708 |
| InChI: | InChI=1S/C12H12N2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H,13-14H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 120 deg C |
| Flash Point: | 203.5°C |
| Boiling Point: | 358.7°Cat760mmHg |
| Density: | 1.156g/cm3 |
| Solubility: | 1 g dissolves in 2500 ml cold water; 1 g dissolves in 107 ml boiling water; 1 g dissolves in 5 ml boiling alcohol; 1 g dissolves in 50 ml ether In water, 322 mg/l @ 25 deg C |
| Flash Point: | 203.5°C |
| Color: | White or slightly-reddish, crystalline powder Grayish-yellow, reddish-gray, or white crystalline powder [Note: Darkens on exposure to air and light]. |
| Safety Data | |
| Hazard Symbols | |
 |
|
