| Identification | |
| Name: | Boronic acid,B-(4-ethenylphenyl)- |
| Synonyms: | Benzeneboronicacid, p-vinyl- (6CI,7CI,8CI);Boronic acid, (4-ethenylphenyl)- (9CI);(4-Ethenylphenyl)boronic acid;(4-Vinylphenyl)boronic acid;(p-Vinylphenyl)boronic acid;4-Styrylboronic acid;p-Vinylbenzeneboronic acid;4-Vinylbenzeneboronic acid; |
| CAS: | 2156-04-9 |
| EINECS: | -0 |
| Molecular Formula: | C8H9BO2 |
| Molecular Weight: | 147.96 |
| InChI: | InChI=1/C8H9BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h2-6,10-11H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139°C |
| Boiling Point: | 306.2°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Refractive index: | 1.539 |
| Appearance: | White light beige crystalline powder |
| Specification: |
4-Vinylphenylboronic acid , with CAS number of 2156-04-9, can be called 4-vinylphenylboronic acid ; 4-boronostyrene ; rarechem ah pb 0202 ; p-styrylboronic acid ; p-vinylphenylboronic acid ; Styrene-4-boronic acid~4-Vinylphenylboronic acid . It is a white light beige crystalline powder. |
| Flash Point: | 139°C |
| Usage: | suzuki reaction |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
