Identification |
Name: | Boronic acid,B-(4-phenoxyphenyl)- |
Synonyms: | Boronicacid, (4-phenoxyphenyl)- (9CI);(4-Phenoxyphenyl)boronic acid;4-Phenoxybenzeneboronic acid;p-Phenoxyphenylboronic acid;Boronic acid, B-(4-phenoxyphenyl)-; |
CAS: | 51067-38-0 |
Molecular Formula: | C12H11BO3 |
Molecular Weight: | 214.02 |
InChI: | InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
Molecular Structure: |
 |
Properties |
Flash Point: | 181.8°C |
Boiling Point: | 377°Cat760mmHg |
Density: | 1.23g/cm3 |
Refractive index: | 1.605 |
Appearance: | white to off-white powder and chunk |
Flash Point: | 181.8°C |
Storage Temperature: | 0-6°C |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |