| Identification |
| Name: | D(-)-4-Hydroxyphenylglycine |
| Synonyms: | D-(-)-4-Hydroxyphenylglycine; (R)-(-)-alpha-Amino-(4-hydroxyphenyl)acetic acid; H-D-Phg(4-OH)-OH; 2-(4-Hydroxy-phenyl)glycin D-Form; 4-HYDROXY-D-PHENYLGLYCINE; PH Dane-acid; D-4-Hydroxyphenylglycine; D(-)4-P-hydroxyphenylglycine |
| CAS: | 22818-40-2 |
| EINECS: | 245-247-7 |
| Molecular Formula: | C8H9NO3 |
| Molecular Weight: | 167.16 |
| InChI: | InChI=1/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.396 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -156 o (C=1, 1 N HCL) |
| Solubility: | 5 g/L (20 oC) |
| Appearance: | White to off-white crystalline powder |
| HS Code: | 29225000 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
