| Identification | |
| Name: | Ethyl fumarate |
| Synonyms: | 2-Butenedioicacid (2E)-, monoethyl ester (9CI);2-Butenedioic acid (E)-, monoethyl ester;Fumaric acid, ethyl ester (6CI,7CI);Fumaric acid, monoethyl ester (8CI);(E)-4-Ethoxy-4-oxo-2-butenoic acid;Ethyl hydrogen fumarate;Monoethylfumarate;Monoethyl trans-2-butenedioate; |
| CAS: | 2459-05-4 |
| EINECS: | 219-544-7 |
| Molecular Formula: | C6H8 O4 |
| Molecular Weight: | 144.13 |
| InChI: | InChI=1/C6H8O4/c1-2-10-6(9)4-3-5(7)8/h3-4H,2H2,1H3,(H,7,8)/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.208 g/cm3 |
| Appearance: | almost white to beige cryatalline power |
| Specification: |
Ethyl fumarate (CAS NO.2459-05-4) is also named as Ethyl hydrogen fumarate ; Fumaric acid, monoethyl ester ; Monoethyl fumarate ; Monoethyl trans-2-butenedioate ; NSC 524101 ; 2-Butenedioic acid (E)-, monoethyl ester (9CI) ; Fumaric acid, ethyl ester . Ethyl fumarate (CAS NO.2459-05-4) is almost white to beige cryatalline power. |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
