| Identification |
| Name: | Ketotifen fumarate |
| Synonyms: | (2E)-But-2-endis?ure--4-(1-methylpiperidin-4-yliden)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-on(1:1);4-(1-methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one (2E)-but-2-enedioate;4-(1-Methylpiperidin-4-ylidene)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thiophen-10-one (2E)-but-2-enedioate (1:1); |
| CAS: | 34580-14-8 |
| EINECS: | 252-100-0 |
| Molecular Formula: | C23H23NO5S |
| Molecular Weight: | 425.49742 |
| InChI: | InChI=1S/C19H19NOS.C4H4O4/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19;5-3(6)1-2-4(7)8/h2-5,8,11H,6-7,9-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| Molecular Structure: |
![(C23H23NO5S) (2E)-But-2-endis?ure--4-(1-methylpiperidin-4-yliden)-4,9-dihydro-10H-benzo[4,5]cyclohepta[1,2-b]thio...](https://img.guidechem.com/casimg/34580-14-8.gif) |
| Properties |
| Density: | 1.236g/cm3 |
| Water Solubility: | Soluble to 100 mM in DMSO |
| Solubility: | Soluble to 100 mM in DMSO |
| Appearance: | White or off-white crystalline powder |
| Biological Activity: | An H 1 receptor antagonist. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |