| Identification | |
| Name: | Diethyl fumarate |
| Synonyms: | Diethyl fumarate, (Fumaric acid diethyl ester); Fumaric acid diethyl ester; trans-2-Butenedioic acid diethyl ester~Fumaric acid diethyl ester |
| CAS: | 623-91-6 |
| EINECS: | 210-819-7 |
| Molecular Formula: | C8H12O4 |
| Molecular Weight: | 172.18 |
| InChI: | InChI=1/C8H12O4/c1-3-11-7(9)5-6-8(10)12-4-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.052 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acids, bases, reducing agents. |
| Refractive index: | 1.4396-1.4416 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | colourless liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29171990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | White crystal or in liquid form |
| Usage: | Comonomer for polymers, eg, with styrene & vinyl chloride. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
