| Identification |
| Name: | Morantel tartrate |
| Synonyms: | 1-Methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine 2,3-dihydroxybutanedioic acid salt |
| CAS: | 26155-31-7 |
| EINECS: | 247-481-5 |
| Molecular Formula: | C12H16N2S.C4H6O6 |
| Molecular Weight: | 370.42068 |
| InChI: | InChI=1S/C12H16N2S.C4H6O6/c1-10-6-9-15-11(10)4-5-12-13-7-3-8-14(12)2;5-1(3(7)8)2(6)4(9)10/h4-6,9H,3,7-8H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/b5-4+;/t;1-,2-/m.1/s1 |
| Molecular Structure: |
![(C12H16N2S.C4H6O6) 1-Methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine 2,3-dihydroxybutanedioic...](https://img1.guidechem.com/chem/e/dict/155/26155-31-7.jpg) |
| Properties |
| Density: | g/cm3 |
| Water Solubility: | Very soluble in water and in alcohol, practically insoluble in ethyl acetate. |
| Solubility: | Very soluble in water and in alcohol, practically insoluble in ethyl acetate. |
| Appearance: | White or pale yellow, crystalline powder. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
