| Identification |
| Name: | Ketanserin tartrate |
| Synonyms: | Ketanserin tartrate hydrate;KJK 945;Prestwick_738;2,4(1H,3H)-Quinazolinedione,3-[2-[4-(4- fluorobenzoyl)-1-piperidinyl]ethyl]-,(2R,3R)- 2,3-dihydroxybutanedioate (1:1);2,3-dihydroxybutanedioic acid; 3-[2-[4-(4-fluorobenzoyl)-1-piperidyl]ethyl]-1H-quinazoline-2,4-dione; hydrate; |
| CAS: | 83846-83-7 |
| EINECS: | 281-062-8 |
| Molecular Formula: | C26H28FN3O9 |
| Molecular Weight: | 545.51 |
| InChI: | InChI=1/C22H22FN3O3.C4H6O6/c23-17-7-5-15(6-8-17)20(27)16-9-11-25(12-10-16)13-14-26-21(28)18-3-1-2-4-19(18)24-22(26)29;5-1(3(7)8)2(6)4(9)10/h1-8,16H,9-14H2,(H,24,29);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2+ |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 6.1/PG 3 |
| Solubility: | Ethanol: 3.3mg/mL |
| Appearance: | UN 2811 6.1/PG 3 |
| Biological Activity: | Selective 5-HT 2A serotonin receptor antagonist; can also be used to discriminate between 5-HT 1D and 5-HT 1B receptor subtypes. |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Safety Data |
| Hazard Symbols |
T: Toxic
|
| |
 |