Identification |
Name: | prop-2-enoic acid - 1,2-diethenylbenzene (1:1) |
Synonyms: | 2-Propenoic acid, polymer with diethenylbenzene;86377-82-4;9052-45-3;AC1L4X8U;Acrylic acid, divinylbenzene polymer;1,2-bis(ethenyl)benzene; prop-2-enoic acid;2-Propenoic acid, polymer with diethenyl benzene;prop-2-enoic acid - 1,2-diethenylbenzene (1:1);I01-18265 |
CAS: | 86377-82-4;9052-45-3 |
Molecular Formula: | C13H14O2 |
Molecular Weight: | 202.2491 |
InChI: | InChI=1/C10H10.C3H4O2/c1-3-9-7-5-6-8-10(9)4-2;1-2-3(4)5/h3-8H,1-2H2;2H,1H2,(H,4,5) |
Molecular Structure: |
|
Properties |
Flash Point: | 71.9°C |
Boiling Point: | 207.3°C at 760 mmHg |
Flash Point: | 71.9°C |
Safety Data |
|
|