| Identification | |
| Name: | L-Tryptophan, ethylester, hydrochloride (1:1) |
| Synonyms: | L-Tryptophan,ethyl ester, monohydrochloride (9CI);Tryptophan, ethyl ester,monohydrochloride, L- (8CI);(S)-Tryptophan ethyl ester hydrochloride; |
| CAS: | 2899-28-7 |
| EINECS: | 220-786-0 |
| Molecular Formula: | C13H16N2O2.HCl |
| Molecular Weight: | 268.73928 |
| InChI: | InChI=1S/C13H16N2O2.ClH/c1-2-17-13(16)11(14)7-9-8-15-12-6-4-3-5-10(9)12;/h3-6,8,11,15H,2,7,14H2,1H3;1H/t11-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Alpha: | 10 º (C=2% IN H2O) |
| Water Solubility: | Soluble in water (5 mg/ml - clear, colorless solution) and ethanol (50 mg/ml-clear colorless solution) |
| Solubility: | Soluble in water (5 mg/ml - clear, colorless solution) and ethanol (50 mg/ml-clear colorless solution) |
| Appearance: | White to off white crystalline powder |
| Specification: |
H-Trp-Oet HCL (2899-28-7) is white powder, known as (S)-Tryptophan ethyl ester hydrochloride ; Ethyl L-tryptophanate HCl ; NSC 401579 ; Tryptophan ethyl ester hydrochloride, L- ; Ethyl L-tryptophanate monohydrochloride ; L-Tryptophan, ethyl ester, monohydrochloride (9CI) . It is incompatible with strong oxidizing agents. When heated to decomposition, it yields Hydrogen chloride, Nitrogen oxides, Carbon monoxide , Carbon dioxide . H-Trp-Oet HCL (2899-28-7) is used as biological and chemical reagent and pharmaceutical intermediate. |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
