| Identification |
| Name: | Tryptophan, methylester, hydrochloride (1:1) |
| Synonyms: | DL-Tryptophan,methyl ester, monohydrochloride;Tryptophan, methyl ester, hydrochloride, DL-(8CI);Tryptophan, methyl ester, monohydrochloride (9CI);DL-Methyltryptophanate monohydrochloride;NSC 34498; |
| CAS: | 5619-09-0 |
| Molecular Formula: | C12H14N2O2.HCl |
| Molecular Weight: | 254.71 |
| InChI: | InChI=1/C12H14N2O2.ClH/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11;/h2-5,7,10,14H,6,13H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 221-222 |
| Density: | 1.245g/cm3 |
| Appearance: | White crystalline powder |
| Storage Temperature: | 2-8°C |
| Usage: | Amino acid derivative that may be used to prepare the corresponding amino acid amide L-Tryptophanamide Hydrochloride (Cat. #T89550) |
| Safety Data |
| |
 |
