| Identification | |
| Name: | L-Tryptophan, methylester, hydrochloride (1:1) |
| CAS: | 7524-52-9 |
| EINECS: | 231-385-5 |
| Molecular Formula: | C12H15ClN2O2 |
| Molecular Weight: | 254.71 |
| InChI: | InChI=1/C12H14N2O2/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11/h2-5,7,10,14H,6,13H2,1H3/p+1/t10-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Alpha: | 18 o (C=5 CH3OH) |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Usage: | Amino acid derivative that may be used to prepare the corresponding amino acid amide L-Tryptophanamide Hydrochloride (Cat. #T89550) |
| Safety Data | |
| Hazard Symbols | |
 |
|
