| Identification | ||
| Name: | 3-Methyl-2-nitrobenzoic acid | |
| Synonyms: | 2-Nitro-m-toluic acid;Benzoic acid, 3-methyl-2-nitro-; | |
| CAS: | 5437-38-7 | |
| EINECS: | 226-610-9 | |
| Molecular Formula: | C8H7NO4 | |
| Molecular Weight: | 181.15 | |
| InChI: | InChI=1/C8H7NO4/c1-5-3-2-4-6(8(10)11)7(5)9(12)13/h2-4H,1H3,(H,10,11) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.392 g/cm3 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Water Solubility: | <0.1 g/100 mL at 22 ºC | |
| Solubility: | <0.1 g/100 mL at 22 ºC in water | |
| Appearance: | white to light beige crystalline powder | |
| Specification: | white to slightly yellow crystalline powder Safety Statements:26-36-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust | |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
Xn:Harmful
|
|
 |
||
