| Identification | |
| Name: | Glutamic acid, sodiumsalt (1:1) |
| Synonyms: | DL-Glutamicacid, monosodium salt;Glutamic acid, monosodium salt (9CI);Glutamic acid,monosodium salt, DL- (8CI);Monosodium DL-glutamate; |
| CAS: | 32221-81-1 |
| Molecular Formula: | C5H8NNaO4 |
| Molecular Weight: | 169.11109 |
| InChI: | InChI=1S/C5H9NO4.Na/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.7 oC |
| Boiling Point: | 333.8 oC at 760 mmHg |
| Stability: | Stable. Incompatible with strong oxidizing agents |
| Water Solubility: | soluble in water, insoluble in alcohol and ether |
| Solubility: | soluble in water, insoluble in alcohol and ether |
| Appearance: | white crystalline solid |
| Specification: |
?Glutamic acid, sodiumsalt (1:1) (CAS NO.32221-81-1) is also named as Monosodium DL-glutamate?; Glutamic acid, monosodium salt ; Glutamic acid, monosodium salt, DL-?.?Glutamic acid, sodiumsalt (1:1) (CAS NO.32221-81-1) is?white crystalline solid. It is?soluble in water, insoluble in alcohol and ether . |
| Flash Point: | 155.7 oC |
| Color: | White free flowing crystals or crystalline powder Forms rhombic prisms when crystallized from water |
| Safety Data | |
 |
|
