| Identification |
| Name: | Benzene,1-fluoro-2-iodo- |
| Synonyms: | 1-Fluoro-2-iodo-5-trifluoromethylbenzene;1-Iodo-2-fluorobenzene;2-Fluoro-1-iodobenzene;2-Fluoroiodobenzene;2-Fluorophenyl iodide;2-Iodo-1-fluorobenzene;2-Iodofluorobenzene;NSC 51766;o-Fluoroiodobenzene;o-Fluorophenyl iodide;o-Iodofluorobenzene; |
| CAS: | 348-52-7 |
| EINECS: | 206-477-3 |
| Molecular Formula: | C6H4FI |
| Molecular Weight: | 222 |
| InChI: | InChI=1/C6H4FI/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.903 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. May discolor on exposure to light. |
| Refractive index: | 1.5899-1.5919 |
| Appearance: | Clear colourless to light yellow liquid |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light. |
| Sensitive: | Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
