| Identification | |
| Name: | Benzene,1-fluoro-4-iodo-2-methyl- |
| Synonyms: | 2-Iodo-5-fluorotoluene;Toluene,2-fluoro-5-iodo- (8CI); |
| CAS: | 452-68-6 |
| EINECS: | 207-206-1 |
| Molecular Formula: | C7H6FI |
| Molecular Weight: | 236.02 |
| InChI: | InChI=1/C7H6FI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 89.7°C |
| Boiling Point: | 207.6°Cat760mmHg |
| Density: | 1.115g/cm3 |
| Refractive index: | 1.578 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 89.7°C |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
