| Identification | |
| Name: | Benzene,1-fluoro-2-iodo-4-methyl- |
| Synonyms: | Toluene,4-fluoro-3-iodo- (8CI);3-Iodo-4-fluorotoluene;4-Fluoro-3-iodotoluene;NSC29032;1-Fluoro-2-iodo-4-methylbenzene;1-Fluor-2-iod-4-methylbenzol; |
| CAS: | 452-82-4 |
| Molecular Formula: | C7H6FI |
| Molecular Weight: | 236.02 |
| InChI: | InChI=1/C7H6FI/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Flash Point: | 60 ºC |
| Density: | 1.833 |
| Refractive index: | 1.5800 |
| Appearance: | colorless to light yellow liquid |
| Specification: | colorless to light yellow liqui Safety Statements:26-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 60 ºC |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
