| Identification | |
| Name: | 4-Bromo-2-fluoroaniline |
| Synonyms: | Bromofluoroaniline4; 2-Fluoro-4-Bromoaniline; 4-bromo-2-fluorobenzenamine |
| CAS: | 367-24-8 |
| EINECS: | 206-685-4 |
| Molecular Formula: | C6H5BrFN |
| Molecular Weight: | 190.01 |
| InChI: | InChI=1/C6H5BrFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Density: | 103 |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, strong acids, strong oxidizing agents. |
| Refractive index: | 1.5885 (25 C) |
| Appearance: | solid |
| Specification: |
? 4-Bromo-2-fluoroaniline ,?its cas register number is 367-24-8. It also can be called?benzenamine, 4-bromo-2-fluoro- ;?4-Bromo-2-fluoroaniline 99% ; 4-Bromo-2-fluoroaniline, 98% . |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
