| Identification | |
| Name: | 4-Chloro-2-fluoroaniline |
| Synonyms: | 2-fluoro-4-chloroaniline;4-Chloro-2-fluorobenzenamine; |
| CAS: | 57946-56-2 |
| EINECS: | 261-034-1 |
| Molecular Formula: | C6H5ClFN |
| Molecular Weight: | 145.56 |
| InChI: | InChI=1/C6H5ClFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.299 |
| Refractive index: | 1.559-1.561 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | colorless liquid ( dark amber liquid with an aniline odor) |
| Specification: | clear slightly yellow to orange-brown liquid Safety Statements:26-37/39-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
