| Identification | |
| Name: | 4-Bromo-3-fluoroaniline |
| Synonyms: | - |
| CAS: | 656-65-5 |
| EINECS: | -0 |
| Molecular Formula: | C6H5BrFN |
| Molecular Weight: | 190.01 |
| InChI: | InChI=1S/C6H5BrFN/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Flash Point: | 105? |
| Density: | 0.982 |
| Refractive index: | 1.471 |
| Appearance: | Beige to brown needles and crystalline powder |
| Specification: |
4-Bromo-3-fluoroaniline , its cas register number is 656-65-5. It also can be called 3-Fluoro-4-bromoaniline ; Benzenamine, 4-bromo-3-fluoro- ; 3-Bromo-4-fluoroaniline ; 3-Fluoro-4-Bromo Aniline ; 4-Bromo-3-fluoroaniline 98% ; 4-Bromo-3-fluorophenylamine . 4-Bromo-3-fluoroaniline (CAS NO.656-65-5) is a beige to brown needles and crystalline powder. |
| Packinggroup: | III |
| Flash Point: | 105? |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
