| Identification | |
| Name: | Cyanoacetic acid |
| Synonyms: | Methyl and Ethyl esters; |
| CAS: | 372-09-8 |
| EINECS: | 206-743-9 |
| Molecular Formula: | C3H3NO2 |
| Molecular Weight: | 85.06 |
| InChI: | InChI=1/C3H3NO2/c4-2-1-3(5)6/h1H2,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.287 g/cm3 |
| Appearance: | yellow-brown liquid with an unpleasant odor |
| Specification: |
?Cyanoacetic acid , its cas register number is 372-09-8. It also can be called?Malonic acid mononitrile ; Malonic mononitrile ; Monocyanoacetic acid ; Acetic acid, 2-cyano- ; Acetic acid, cyano- .It is a?yellow-brown liquid with an unpleasant odor and it can?sinks and mixes with water. |
| Packinggroup: | II |
| Sensitive: | Hygroscopic |
| Color: | Hygroscopic crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
