Identification |
Name: | 3-Fluoroaniline |
Synonyms: | 3-fluorobenzenamine; 1-Amino-3-fluorobenzene |
CAS: | 372-19-0 |
EINECS: | 206-747-0 |
Molecular Formula: | C6H6FN |
Molecular Weight: | 111.12 |
InChI: | InChI=1/C6H6FN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
Molecular Structure: |
|
Properties |
Transport: | UN 2941 |
Density: | 1.156 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.543-1.545 |
Water Solubility: | insoluble |
Solubility: | insoluble in water |
Appearance: | yellow to brown liquid |
Packinggroup: | III |
HS Code: | 29214210 |
Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|