| Identification |
| Name: | 3-Fluoroaniline |
| Synonyms: | 3-fluorobenzenamine; 1-Amino-3-fluorobenzene |
| CAS: | 372-19-0 |
| EINECS: | 206-747-0 |
| Molecular Formula: | C6H6FN |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1/C6H6FN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2941 |
| Density: | 1.156 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.543-1.545 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | yellow to brown liquid |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
