| Identification |
| Name: | 3-Chloro-4-fluoroaniline |
| Synonyms: | 3-chloro-4-fluorobenzenamine |
| CAS: | 367-21-5 |
| EINECS: | 206-682-8 |
| Molecular Formula: | C6H5ClFN |
| Molecular Weight: | 145.56 |
| InChI: | InChI=1/C6H5ClFN/c7-5-3-4(9)1-2-6(5)8/h1-3H,9H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Density: | 1,226 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acids, acid chlorides, acid anhydrides, chloroformates. May be air-sensitive. |
| Refractive index: | 1,54-1,542 |
| Solubility: | 10 g/L (20 oC) in water |
| Appearance: | white crystalline powder |
| Packinggroup: | III |
| HS Code: | 29214210 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Do not expose to air. Store under an inert atmosphere. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
