| Identification | |
| Name: | difluoroacetic acid |
| Synonyms: | - |
| CAS: | 381-73-7 |
| EINECS: | 206-839-0 |
| Molecular Formula: | C2H2F2O2 |
| Molecular Weight: | 96.03 |
| InChI: | InChI=1/C2H2F2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.526 |
| Refractive index: | 1.342-1.345 |
| Water Solubility: | 3.666e+005 mg/L at 25ºC |
| Solubility: | 3.666e+005 mg/L at 25ºC |
| Appearance: | colorless to pale yellow transparent liquid |
| Specification: |
Difluoroacetic acid (381-73-7) should be kept away from sources of ignition. It should be store in a cool, dry place, or stored in a tightly closed container, corrosives area. Difluoroacetic acid (381-73-7) is stable under normal temperatures and pressures. Difluoroacetic acid (381-73-7)should avoid the condition like incompatible materials,moisture. It is incompatibilities with other materials strong oxidizing agents strong bases, lithium aluminum hydride. Its hazardous decomposition products are carbon monoxide, carbon dioxide, hydrogen fluoride gas. Its hazardous polymerization has not been reported. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
