Identification |
Name: | DL-4-Fluoro-Alpha-methylbenzylamine |
Synonyms: | (+/-)-4-Fluoro-alpha-methylbenzylamine; (+/-)-1-(4-Fluorophenyl)ethylamine |
CAS: | 403-40-7 |
EINECS: | 206-958-8 |
Molecular Formula: | C8H10FN |
Molecular Weight: | 139.17 |
InChI: | InChI=1/C8H10FN/c1-6(10)7-2-4-8(9)5-3-7/h2-6H,10H2,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2735 |
Melting Point: | -30°C |
Density: | 1.059 |
Refractive index: | 1.502 |
Appearance: | Clear colorless to yellow or light orange liquid |
Specification: | Clear colorless to yellow or light orange liquid Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Packinggroup: | III |
Sensitive: | Air Sensitive |
Safety Data |
Hazard Symbols |
C:Corrosive
|
|
|