| Identification |
| Name: | L(-)-Alpha-Methylbenzylamine |
| CAS: | 2627-86-3 |
| EINECS: | 220-098-0 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7(9)8-5-3-2-4-6-8/h2-7H,9H2,1H3/t7-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Density: | 0.94 |
| Stability: | Stable under normal temperatures and pressures. Absorbs carbon dioxide from the air. |
| Refractive index: | 1.525-1.527 |
| Alpha: | -40 o (NEAT) |
| Water Solubility: | slightly soluble |
| Solubility: | 4.2% |
| Appearance: | clear liquid |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
