| Identification | |
| Name: | 4-Methylbenzylamine |
| Synonyms: | p-Xylylamine; 4-Xylylamine |
| CAS: | 104-84-7 |
| EINECS: | 203-243-2 |
| Molecular Formula: | C8H11N |
| Molecular Weight: | 121.18 |
| InChI: | InChI=1/C8H11N/c1-7-2-4-8(6-9)5-3-7/h2-5H,6,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.952 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.533-1.536 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | colorless to yellow clear liquid |
| Specification: | Colorless to light yellow liqui Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| HS Code: | 29214980 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
