| Identification | |
| Name: | cyproheptadine hydrochloride sesquihydrate |
| Synonyms: | Cyproheptadine Hcl |
| CAS: | 41354-29-4 |
| EINECS: | 213-535-1 |
| Molecular Formula: | C21H21N?HCl |
| Molecular Weight: | 377.90492 |
| InChI: | InChI=1S/C21H21N.ClH.3H2O/c1-22-14-12-18(13-15-22)21-19-8-4-2-6-16(19)10-11-17-7-3-5-9-20(17)21;;;;/h2-11H,12-15H2,1H3;1H;3*1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | g/cm3 |
| Water Solubility: | soluble in water, freely soluble in methanol, sparingly soluble in ethanol, soluble in chloroform, and practically insoluble in ether. |
| Solubility: | soluble in water, freely soluble in methanol, sparingly soluble in ethanol, soluble in chloroform, and practically insoluble in ether. |
| Appearance: | white to slightly yellowish crystalline solid |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
