| Identification |
| Name: | 3-Fluoro-2-methylaniline |
| Synonyms: | o-Toluidine,3-fluoro- (6CI,7CI,8CI); (3-Fluoro-2-methylphenyl)amine;1-Amino-3-fluoro-2-methylbenzene; 2-Methyl-3-fluoroaniline; 3-Fluoro-2-methylaniline;6-Amino-2-fluorotoluene |
| CAS: | 443-86-7 |
| EINECS: | 207-142-4 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-6(8)3-2-4-7(5)9/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Density: | 1.099 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.542-1.544 |
| Solubility: | Slightly soluble |
| Appearance: | yellow clear liquid |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
