| Identification | |
| Name: | 3-Nitrotoluene |
| Synonyms: | 1-methyl-3-nitrobenzene; 3-methylnitrobenzene; m-nitrophenylmethane; m-Nitrotoluol; M-nitrotoluene |
| CAS: | 99-08-1 |
| EINECS: | 202-728-6 |
| Molecular Formula: | C7H7NO2 |
| Molecular Weight: | 137.14 |
| InChI: | InChI=1/C7H7NO2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1664 |
| Density: | 1.157 |
| Stability: | Stable. Combustible. Incompatible with reducing agents, strong oxidizing agents, strong bases. |
| Refractive index: | 1.545-1.547 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | yellow-green liquid |
| Specification: |
Yellow crystals which melt at 59°F to a yellow liquid. Often therefore encountered as a liquid. Flash point 223°F. Boiling point 450°F. Insoluble in water. Toxic by inhalation and ingestion. |
| Packinggroup: | II |
| HS Code: | 29042000 |
| Storage Temperature: | 2-8°C |
| Color: | YELLOW LIQUID Yellow liquid. [Note: A solid below 59 degrees F.] |
| Usage: | Manufacture of dyes, toluidines, nitrobenzoic acids. Nitrotoluene. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
