| Identification | |
| Name: | Phenol,3-fluoro-4-methoxy- |
| Synonyms: | 3-Fluoro-4-methoxyphenol; |
| CAS: | 452-11-9 |
| Molecular Formula: | C7H7FO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H7FO2/c1-10-7-3-2-5(9)4-6(7)8/h2-4,9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.224g/cm3 |
| Refractive index: | 1.512 |
| Specification: |
The 3-Fluoro-4-methoxyphenol with the CAS number 452-11-9 is also called Phenol,3-fluoro-4-methoxy-. Its molecular formula is C7H7FO2. The product category is Phenol & Thiophenol & Mercaptan. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 3-Fluoro-4-methoxyphenol are: (1)ACD/LogP: 2.06; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 12; (6)ACD/BCF (pH 7.4): 12; (7)ACD/KOC (pH 5.5): 202; (8)ACD/KOC (pH 7.4): 200; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 29.46 Å2; (13)Index of Refraction: 1.512; (14)Molar Refractivity: 34.807 cm3; (15)Molar Volume: 116.075 cm3; (16)Polarizability: 13.798×10-24cm3; (17)Surface Tension: 36.898 dyne/cm; (18)Enthalpy of Vaporization: 50.508 kJ/mol; (19)Vapour Pressure: 0.016 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
