| Identification | |
| Name: | Benzene,1-fluoro-3-iodo-2-methyl- |
| Synonyms: | Toluene,2-fluoro-6-iodo- (8CI);1-Fluoro-3-iodo-2-methylbenzene;2-Fluoro-6-iodotoluene;1-Fluor-3-iod-2-methylbenzol; |
| CAS: | 443-85-6 |
| Molecular Formula: | C7H6FI |
| Molecular Weight: | 236.03 |
| InChI: | InChI=1/C7H6FI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | 84 oC |
| Density: | 1.8080 |
| Refractive index: | 1.5830 |
| Appearance: | colorless to light yellow liquid |
| Specification: | colorless to light yellow liqui Safety Statements:26-39-61 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 39:Wear eye/face protection 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 84 oC |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
