Identification |
Name: | Benzene,1-fluoro-3-iodo-2-methyl- |
Synonyms: | Toluene,2-fluoro-6-iodo- (8CI);1-Fluoro-3-iodo-2-methylbenzene;2-Fluoro-6-iodotoluene;1-Fluor-3-iod-2-methylbenzol; |
CAS: | 443-85-6 |
Molecular Formula: | C7H6FI |
Molecular Weight: | 236.03 |
InChI: | InChI=1/C7H6FI/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 2810 |
Flash Point: | 84 oC |
Density: | 1.8080 |
Refractive index: | 1.5830 |
Appearance: | colorless to light yellow liquid |
Specification: | colorless to light yellow liqui Safety Statements:26-39-61 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 39:Wear eye/face protection 61:Avoid release to the environment. Refer to special instructions
safety data sheet |
Flash Point: | 84 oC |
Safety Data |
Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
|
|