Identification |
Name: | 2-Fluoro-4-methylphenol |
Synonyms: | p-Cresol,2-fluoro- (6CI,7CI,8CI); 2-Fluoro-4-methylphenol; 2-Fluoro-p-cresol |
CAS: | 452-81-3 |
Molecular Formula: | C7H7FO |
Molecular Weight: | 126.13 |
InChI: | InChI=1/C7H7FO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2922 |
Flash Point: | 66.4°C |
Boiling Point: | 173°Cat760mmHg |
Density: | 1.164g/cm3 |
Refractive index: | 1.513 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 66.4°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |