| Identification |
| Name: | 2-Methoxy-4-methylphenol |
| Synonyms: | Creosol(6CI); p-Cresol, 2-methoxy- (8CI); 2-Methoxy-4-methylphenol;2-Methoxy-p-cresol; 3-Methoxy-4-hydroxytoluene; 4-Hydroxy-3-methoxy-1-methylbenzene;4-Hydroxy-3-methoxytoluene; 4-Methyl-2-methoxyphenol; 4-Methylguaiacol;Homoguaiacol; NSC 4969; p-Creosol; p-Methylguaiacol |
| CAS: | 93-51-6 |
| EINECS: | 202-252-9 |
| Molecular Formula: | C8H10O2 |
| Molecular Weight: | 138.16 |
| InChI: | InChI=1/C8H10O2/c1-6-3-4-7(9)8(5-6)10-2/h3-5,9H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 211 ºF |
| Boiling Point: | 221-222ºC |
| Density: | 1.092 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.536-1.538 |
| Solubility: | Slightly soluble |
| Appearance: | clear liquid |
| Packinggroup: | II |
| HS Code: | 29095090 |
| Flash Point: | 211 ºF |
| Storage Temperature: | Keep away from heat, sparks, and flame. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Reacts with hydrogen halide to give a catechol. . |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
