| Identification | |
| Name: | 4-Fluorophenylacetyl chloride |
| Synonyms: | - |
| CAS: | 459-04-1 |
| EINECS: | -0 |
| Molecular Formula: | C8H6ClFO |
| Molecular Weight: | 172.584043 |
| InChI: | InChI=1S/C8H6ClFO/c9-8(11)5-6-1-3-7(10)4-2-6/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Melting Point: | 47-48ºC |
| Density: | 1.259 |
| Refractive index: | 1.511-1.513 |
| Water Solubility: | reacts with water |
| Solubility: | reacts with water |
| Appearance: | clear yellow liquid. |
| Specification: | clear yellow liquid Safety Statements:45-36/37/39-26-27 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing |
| Packinggroup: | II |
| Storage Temperature: | Store at RT. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
