| Identification | |
| Name: | 4-Nitrobenzyl chloride |
| Synonyms: | alpha-Chloro-4-nitrotoluene; Nitrobenzylchloride; 98%; p-Nitrobenzyl chloride; a-Chloro-4-nitrotoluene |
| CAS: | 100-14-1 |
| EINECS: | 202-822-7 |
| Molecular Formula: | C7H6ClNO2 |
| Molecular Weight: | 171.58 |
| InChI: | InChI=1/C7H6ClNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Density: | 1.33 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases, amines, moisture, alcohols. Corrodes steel. Reacts slowly with water. Combustible. |
| Refractive index: | 1.574 |
| Solubility: | reacts |
| Appearance: | Light yellow crystalline powder |
| Specification: | white to light yellow crystal powde Safety Statements:26-36/37/39-45-27 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 27:Take off immediately all contaminated clothing |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Plates or needles from alcohol |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
