| Identification | |
| Name: | Pyridine,2-fluoro-4-methyl- |
| Synonyms: | 4-Picoline,2-fluoro- (8CI);2-Fluoro-4-picoline; |
| CAS: | 461-87-0 |
| EINECS: | -0 |
| Molecular Formula: | C6H6FN |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1S/C6H6FN/c1-5-2-3-8-6(7)4-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 1.078 |
| Refractive index: | 1.472 |
| Appearance: | Clear colourless to light yellow liquid |
| Specification: | Clear colourless to light yellow liquid Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
