| Identification | |
| Name: | Pyridine,4-fluoro-2-methyl- |
| Synonyms: | 2-Picoline,4-fluoro- (6CI,7CI,8CI);4-Fluoro-2-picoline;4-FLUORO-2-METHYLPYRIDINE 97%; |
| CAS: | 766-16-5 |
| Molecular Formula: | C6H6 F N |
| Molecular Weight: | 111.12 |
| InChI: | InChI=1/C6H6FN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.077g/cm3 |
| Refractive index: | 1.477 |
| Specification: |
The 4-Fluoro-2-methylpyridine with cas registry number of 766-16-5, is also called 2-Picoline,4-fluoro- (6CI,7CI,8CI) ; 4-FLUORO-2-METHYLPYRIDINE 97% . The 4-Fluoro-2-methylpyridine belongs to the following product categorie: Pyridines . Physical properties of 4-Fluoro-2-methylpyridine :(1)ACD/LogP: 1.24; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.15; (4)ACD/LogD (pH 7.4): 1.24; (5)ACD/BCF (pH 5.5): 4.23; (6)ACD/BCF (pH 7.4): 5.12; (7)ACD/KOC (pH 5.5): 92.52; (8)ACD/KOC (pH 7.4): 112.01; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 12.89 Å2; (13)Index of Refraction: 1.477; (14)Molar Refractivity: 29.16 cm3; (15)Molar Volume: 103.1 cm3; (16)Polarizability: 11.56×10-24cm3; (17)Surface Tension: 32.4 dyne/cm; (18)Enthalpy of Vaporization: 35.27 kJ/mol; (19)Vapour Pressure: 11.9 mmHg at 25°C. You can still convert the following datas into molecular structure: (1)SMILES:Fc1ccnc(c1)C; (2)InChI:InChI=1/C6H6FN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3; (3)InChIKey:LEJYGRVERQVBLB-UHFFFAOYAC; (4)Std. InChI:; (5)InChI=1S/C6H6FN/c1-5-4-6(7)2-3-8-5/h2-4H,1H3; (6)Std. InChIKey:LEJYGRVERQVBLB-UHFFFAOYSA-N. |
| Safety Data | |
 |
|
