Identification |
Name: | Propiolic acid |
Synonyms: | 2-Propynoic acid; Acetylenecarboxylic acid~Propargylic acid~Propynoic acid; Propargylic acid; Propiolic acid, (Propynoic acid) |
CAS: | 471-25-0 |
EINECS: | 207-437-8 |
Molecular Formula: | C3H2O2 |
Molecular Weight: | 70.05 |
InChI: | InChI=1/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) |
Molecular Structure: |
|
Properties |
Transport: | UN 2920 |
Density: | 1.138 |
Stability: | Stable. Incompatible with bases, oxidizing agents, reducing agents. Combustible. |
Refractive index: | 1.4315-1.4335 |
Water Solubility: | miscible |
Solubility: | miscible |
Appearance: | viscous yellow liquid |
Specification: | viscous yellow liquid Safety Statements:26-36/37/39-45-24/25-7/9 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 7/9:Keep container tightly closed and in a well-ventilated
place |
Packinggroup: | II |
HS Code: | 29161980 |
Safety Data |
Hazard Symbols |
T:Toxic
|
|
|