| Identification | |
| Name: | Propiolic acid |
| Synonyms: | 2-Propynoic acid; Acetylenecarboxylic acid~Propargylic acid~Propynoic acid; Propargylic acid; Propiolic acid, (Propynoic acid) |
| CAS: | 471-25-0 |
| EINECS: | 207-437-8 |
| Molecular Formula: | C3H2O2 |
| Molecular Weight: | 70.05 |
| InChI: | InChI=1/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.138 |
| Stability: | Stable. Incompatible with bases, oxidizing agents, reducing agents. Combustible. |
| Refractive index: | 1.4315-1.4335 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | viscous yellow liquid |
| Specification: | viscous yellow liquid Safety Statements:26-36/37/39-45-24/25-7/9 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 24/25:Avoid contact with skin and eyes 7/9:Keep container tightly closed and in a well-ventilated place |
| Packinggroup: | II |
| HS Code: | 29161980 |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
