| Identification | |
| Name: | Isonipecotic acid |
| Synonyms: | 4-Piperidinecarboxylic acid; Hexahydroisonicotinic acid; DL-Isonipecotic acid; 4-Piperidinecaboxylic Acid; Boc-isonipecotic acid; H-DL-Inp-OH~(+/-)-Piperidine-4-carboxylic acid |
| CAS: | 498-94-2 |
| EINECS: | 207-872-3 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c8-6(9)5-1-3-7-4-2-5/h5,7H,1-4H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.125 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Darkens at 300 C. |
| Refractive index: | 1.478 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white to faint pink-beige powder |
| Specification: | white to faint pink-beige powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29333999 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
