| Identification | |
| Name: | Ethyl nipecotate |
| Synonyms: | 3-Piperidinecarboxylicacid, ethyl ester;Nipecoticacid, ethyl ester (7CI,8CI);3-(Ethoxycarbonyl)piperidine;Ethyl 3-piperidinecarboxylate;NSC 158451; |
| CAS: | 5006-62-2 |
| EINECS: | 225-681-3 |
| Molecular Formula: | C8H15NO2 |
| Molecular Weight: | 157.21 |
| InChI: | InChI=1S/C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h7,9H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01g/cm3 |
| Refractive index: | 1.458-1.461 |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible |
| Appearance: | clear colorless to yellow-brown liquid |
| Specification: |
?Ethyl nipecotate ,its cas register number is 5006-62-2. It also can be called??Piperidine-3-carboxylic acid ethyl ester ; Nipecotic acid ethyl ester ; Nipecotinic acid ethyl ester ; 3-Piperidinecarboxylic acid ethyl ester ; Ethyl 3-piperidinecarboxylate and so on. |
| Safety Data | |
 |
|
