| Identification |
| Name: | Suberic acid |
| Synonyms: | Octanedioic acid; Cork Acid; 1,6-Hexanedicarboxylic Acid; SA; RARECHEM AL BO 0184; OCTANEDIOC ACID; KORK ACID; HEXANE-1,6-DICARBOXYLIC ACID; DICARBOXYLIC ACID C8 |
| CAS: | 505-48-6 |
| EINECS: | 208-010-9 |
| Molecular Formula: | C8H14O4 |
| Molecular Weight: | 174.2 |
| InChI: | InChI=1/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.162g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, reducing agents, bases. |
| Solubility: | Slightly soluble |
| Appearance: | white crystals |
| HS Code: | 29171990 |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Substance is used in the plastics industry. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
