| Identification | |
| Name: | DICYCLOPENTADIENYL METHACRYLATE |
| Synonyms: | MAA dicyclopentadienyl ester; Methacrylic acid dicyclopentadienyl ester |
| CAS: | 51178-59-7 |
| EINECS: | 257-033-0 |
| Molecular Formula: | C14H16O2 |
| Molecular Weight: | 216.28 |
| InChI: | InChI=1/C14H16O2/c1-8(2)14(15)16-12-6-5-11-9-3-4-10(7-9)13(11)12/h3-6,9-13H,1,7H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 200kgs |
| Flash Point: | 119.8°C |
| Boiling Point: | 295.2°Cat760mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.559 |
| Solubility: | Appearance:clear to amber liquid Transport Information:200kgs Hazard Symbols:4.2 (Packing Group: II) UN NO. |
| Appearance: | clear to amber liquid |
| Flash Point: | 119.8°C |
| Safety Data | |
| Hazard Symbols |
4.2 (Packing Group: II) UN NO.
|
 |
|
