| Identification | |
| Name: | Phenol,2-(2-chloro-1-methoxyethoxy)-, 1-(N-methylcarbamate) |
| Synonyms: | Phenol,2-(2-chloro-1-methoxyethoxy)-, methylcarbamate (9CI); BAS 263; BAS 263-51I; BAS263-52I; BAS 263I; BASF 263; Cloethocarb; Lance;o-(2-Chloro-1-methoxyethoxy)phenyl methylcarbamate |
| CAS: | 51487-69-5 |
| EINECS: | 257-236-4 |
| Molecular Formula: | C11H14 Cl N O4 |
| Molecular Weight: | 259.71 |
| InChI: | InChI=1/C11H14ClNO4/c1-13-11(14)17-9-6-4-3-5-8(9)16-10(7-12)15-2/h3-6,10H,7H2,1-2H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2757 |
| Flash Point: | 175.2°C |
| Boiling Point: | 366.1°Cat760mmHg |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.515 |
| Specification: |
Lance with cas registry number of 51487-69-5 is a kind of insecticides, also known as 2-(2-Chloro-1-methoxyethoxy)phenol methylcarbamate ; 2-(2-Chloro-1-methoxyethoxy)phenyl methylcarbamate (9CI) ; AI3-29534 ; BAS 263 ; BAS 263-51I ; BAS 263-52I ; BAS 263I ; BASF 263 ; Cloethocarb ; Cloethocarb [BSI:ISO] ; Phenol, 2-(2-chloro-1-methoxyethoxy)-, methylcarbamate ; o-(2-Chloro-1-methoxyethoxy)phenyl methylcarbamate . |
| Packinggroup: | III |
| Flash Point: | 175.2°C |
| Safety Data | |
 |
|
