| Identification |
| Name: | 5-Chloro-2-mercaptobenzothiazole |
| Synonyms: | 5-Chloro-2-benzothiazolethiol; 5-Chloro-2-mercaptobenzthiazol; ; 2(3H)-Benzothiazolethione,4-chloro-(9CI); 2-mercapto-5-chloro benzothiazole |
| CAS: | 5331-91-9 |
| EINECS: | 226-235-0 |
| Molecular Formula: | C7H4ClNS2 |
| Molecular Weight: | 201.69 |
| InChI: | InChI=1/C7H4ClNS2/c8-4-1-2-6-5(3-4)9-7(10)11-6/h1-3H,(H,9,10) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 155.3°C |
| Boiling Point: | 324 |
| Density: | 1.6g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.785 |
| Solubility: | Insoluble |
| Appearance: | Light yellow to beige solid. |
| Flash Point: | 155.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
