| Identification |
| Name: | 3'-methylacetanilide |
| Synonyms: | 3-Methylacetanilide; m-Acetotoluidide; N-Acetyl-M-Toluidine |
| CAS: | 537-92-8 |
| EINECS: | 208-678-1 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c1-7-4-3-5-9(6-7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs
|
| Flash Point: | 222.1°C |
| Density: | 1.52g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.567 |
| Water Solubility: | slightly
AUTOIGNITION |
| Solubility: | slightly
AUTOIGNITION |
| Appearance: | white solid |
| Flash Point: | 222.1°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |