| Identification | |
| Name: | N-Methylacetanilide |
| Synonyms: | Acetanilide,N-methyl- (6CI,7CI,8CI); Acetomethylanilide; Exalgin; Methylantifebrin;Methylazol; N-Acetyl-N-methylaniline; N-Methyl-N-phenylacetamide;N-Methylacetanilide; NSC 2140; Oxalgin; Phenylmethylacetamide |
| CAS: | 579-10-2 |
| EINECS: | 209-436-8 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.192 |
| InChI: | InChI=1/C9H11NO/c1-8(11)10(2)9-6-4-3-5-7-9/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 101°C |
| Flash Point: | 93.2°C |
| Boiling Point: | 146 °C / 30mmHg |
| Density: | 1.057g/cm3 |
| Refractive index: | 1.554 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 93.2°C |
| Safety Data | |
 |
|
