| Identification | |
| Name: | 4'-methylacetanilide |
| Synonyms: | p-Acetotoluidide |
| CAS: | 103-89-9 |
| EINECS: | 203-155-4 |
| Molecular Formula: | C9H11NO |
| Molecular Weight: | 149.19 |
| InChI: | InChI=1/C9H11NO/c1-7-3-5-9(6-4-7)10-8(2)11/h3-6H,1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.212 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.567 |
| Solubility: | slightly SOLVENT |
| Appearance: | off white to brown flake |
| Specification: | BEIGE TO LIGHT BROWN CRYSTALS OR CRYST. POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29242995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
