| Identification | |
| Name: | 2,6-Dichloropurine |
| Synonyms: | Purine, 2,6-dichloro-;2,6-Dichloro-1H-purine;2,6-Dichloro purine 98%;2,6-Dichloropurine 99%;Purine, 2,6-dichloro- (VAN) (8CI);2,6-dichloro-5H-purine;1H-Purine, 2,6-dichloro-;2,6-dichloro-9H-purine;9H-purine, 2,6-dichloro-;1H-Purine, 2,6-dichloro- (9CI); |
| CAS: | 5451-40-1 |
| EINECS: | 226-681-6 |
| Molecular Formula: | C5H2Cl2N4 |
| Molecular Weight: | 189 |
| InChI: | InChI=1/C5H2Cl2N4/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H,8,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.792 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.741 |
| Water Solubility: | soluble |
| Solubility: | soluble Appearance:white powder Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | white powder |
| Specification: | white to light yellow crystal powder usageEng:Suzuki-Miyaura cross-coupling between halopurines and arylboronic acids in water-acetonitrile.1 Safety Statements:22-24/25-37/39-26-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Usage: | Suzuki-Miyaura cross-coupling between halopurines and arylboronic acids in water-acetonitrile.1 |
| Safety Data | |
| Hazard Symbols | |
 |
|
